C18H26O4S — CID 69438454
ethyl 2-(benzylsulfanylmethyl)-3-(oxan-4-yloxy)propanoate (PubChem CID 69438454) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is ethyl 2-(benzylsulfanylmethyl)-3-(oxan-4-yloxy)propanoate.
| Compound Name | ethyl 2-(benzylsulfanylmethyl)-3-(oxan-4-yloxy)propanoate |
|---|---|
| PubChem CID | 69438454 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl 2-(benzylsulfanylmethyl)-3-(oxan-4-yloxy)propanoate |
| SMILES | CCOC(=O)C(COC1CCOCC1)CSCc1ccccc1 |
| InChI | InChI=1S/C18H26O4S/c1-2-21-18(19)16(12-22-17-8-10-20-11-9-17)14-23-13-15-6-4-3-5-7-15/h3-7,16-17H,2,8-14H2,1H3 |
| InChIKey | HNJQCUWVMITETM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |