C26H50N4O5 — CID 69461671
1-ethyl-3-[6-[6-(3-ethyl-2,5-dihydroxyimidazolidin-1-yl)-5,5-dimethylhexoxy]-2,2-dimethylhexyl]imidazolidine-2,4-dione (PubChem CID 69461671) has the molecular formula C26H50N4O5 and a molecular weight of 498.71 g/mol. Its IUPAC name is 1-ethyl-3-[6-[6-(3-ethyl-2,5-dihydroxyimidazolidin-1-yl)-5,5-dimethylhexoxy]-2,2-dimethylhexyl]imidazolidine-2,4-dione.
| Compound Name | 1-ethyl-3-[6-[6-(3-ethyl-2,5-dihydroxyimidazolidin-1-yl)-5,5-dimethylhexoxy]-2,2-dimethylhexyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 69461671 |
| Molecular Formula | C26H50N4O5 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.38 |
| IUPAC Name | 1-ethyl-3-[6-[6-(3-ethyl-2,5-dihydroxyimidazolidin-1-yl)-5,5-dimethylhexoxy]-2,2-dimethylhexyl]imidazolidine-2,4-dione |
| SMILES | CCN1CC(=O)N(CC(C)(C)CCCCOCCCCC(C)(C)CN2C(O)CN(CC)C2O)C1=O |
| InChI | InChI=1S/C26H50N4O5/c1-7-27-17-21(31)29(23(27)33)19-25(3,4)13-9-11-15-35-16-12-10-14-26(5,6)20-30-22(32)18-28(8-2)24(30)34/h21,23,31,33H,7-20H2,1-6H3 |
| InChIKey | JYRKKJHNCGVYME-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|