C41H39F3O7S — CID 69471769
(2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[3-(trifluoromethylsulfonyl)phenyl]oxane (PubChem CID 69471769) has the molecular formula C41H39F3O7S and a molecular weight of 732.82 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[3-(trifluoromethylsulfonyl)phenyl]oxane.
| Compound Name | (2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[3-(trifluoromethylsulfonyl)phenyl]oxane |
|---|---|
| PubChem CID | 69471769 |
| Molecular Formula | C41H39F3O7S |
| Molecular Weight | 732.82 g/mol |
| Exact Mass | 732.24 |
| IUPAC Name | (2R,3R,4R,5S,6S)-3,4,5-tris(phenylmethoxy)-2-(phenylmethoxymethyl)-6-[3-(trifluoromethylsulfonyl)phenyl]oxane |
| SMILES | O=S(=O)(c1cccc([C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)C2OCc2ccccc2)c1)C(F)(F)F |
| InChI | InChI=1S/C41H39F3O7S/c42-41(43,44)52(45,46)35-23-13-22-34(24-35)37-39(49-27-32-18-9-3-10-19-32)40(50-28-33-20-11-4-12-21-33)38(48-26-31-16-7-2-8-17-31)36(51-37)29-47-25-30-14-5-1-6-15-30/h1-24,36-40H,25-29H2/t36-,37+,38-,39?,40+/m1/s1 |
| InChIKey | OYGRUMKICCHJDL-IXJSTGKNSA-N |
| XLogP | 8.39 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.82 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |