C7H4F3O2S- — CID 69481341
(3,4,5-trifluorophenyl)methanesulfinate (PubChem CID 69481341) has the molecular formula C7H4F3O2S- and a molecular weight of 209.17 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl)methanesulfinate.
| Compound Name | (3,4,5-trifluorophenyl)methanesulfinate |
|---|---|
| PubChem CID | 69481341 |
| Molecular Formula | C7H4F3O2S- |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | (3,4,5-trifluorophenyl)methanesulfinate |
| SMILES | O=S([O-])Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C7H5F3O2S/c8-5-1-4(3-13(11)12)2-6(9)7(5)10/h1-2H,3H2,(H,11,12)/p-1 |
| InChIKey | DNQWDVYQZRQULB-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|