C25H24F3N5O — CID 69490042
4-[4-(triazol-1-yl)butyl]-N-[[2-[2-[3-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline (PubChem CID 69490042) has the molecular formula C25H24F3N5O and a molecular weight of 467.50 g/mol. Its IUPAC name is 4-[4-(triazol-1-yl)butyl]-N-[[2-[2-[3-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline.
| Compound Name | 4-[4-(triazol-1-yl)butyl]-N-[[2-[2-[3-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline |
|---|---|
| PubChem CID | 69490042 |
| Molecular Formula | C25H24F3N5O |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 4-[4-(triazol-1-yl)butyl]-N-[[2-[2-[3-(trifluoromethyl)phenyl]ethenyl]-1,3-oxazol-4-yl]methyl]aniline |
| SMILES | FC(F)(F)c1cccc(C=Cc2nc(CNc3ccc(CCCCn4ccnn4)cc3)co2)c1 |
| InChI | InChI=1S/C25H24F3N5O/c26-25(27,28)21-6-3-5-20(16-21)9-12-24-31-23(18-34-24)17-29-22-10-7-19(8-11-22)4-1-2-14-33-15-13-30-32-33/h3,5-13,15-16,18,29H,1-2,4,14,17H2 |
| InChIKey | MLCCWWCMJBWHKK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 68.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|