C14H13N2O2+ — CID 6954633
4-amino-1-ethylchromeno[3,4-c]pyridin-3-ium-5-one (PubChem CID 6954633) has the molecular formula C14H13N2O2+ and a molecular weight of 241.27 g/mol. Its IUPAC name is 4-amino-1-ethylchromeno[3,4-c]pyridin-3-ium-5-one.
| Compound Name | 4-amino-1-ethylchromeno[3,4-c]pyridin-3-ium-5-one |
|---|---|
| PubChem CID | 6954633 |
| Molecular Formula | C14H13N2O2+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 4-amino-1-ethylchromeno[3,4-c]pyridin-3-ium-5-one |
| SMILES | CCc1c[nH+]c(N)c2c(=O)oc3ccccc3c12 |
| InChI | InChI=1S/C14H12N2O2/c1-2-8-7-16-13(15)12-11(8)9-5-3-4-6-10(9)18-14(12)17/h3-7H,2H2,1H3,(H2,15,16)/p+1 |
| InChIKey | PSVZZSLFAVRNFS-UHFFFAOYSA-O |
| XLogP | 1.90 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|