C18H19N2+ — CID 6992196
(2R,5S,6R)-2,6-dimethyl-4,5-diphenyl-3-aza-1-azoniabicyclo[3.1.0]hex-3-ene (PubChem CID 6992196) has the molecular formula C18H19N2+ and a molecular weight of 263.36 g/mol. Its IUPAC name is (2R,5S,6R)-2,6-dimethyl-4,5-diphenyl-3-aza-1-azoniabicyclo[3.1.0]hex-3-ene.
| Compound Name | (2R,5S,6R)-2,6-dimethyl-4,5-diphenyl-3-aza-1-azoniabicyclo[3.1.0]hex-3-ene |
|---|---|
| PubChem CID | 6992196 |
| Molecular Formula | C18H19N2+ |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (2R,5S,6R)-2,6-dimethyl-4,5-diphenyl-3-aza-1-azoniabicyclo[3.1.0]hex-3-ene |
| SMILES | C[C@@H]1N=C(c2ccccc2)[C@]2(c3ccccc3)[C@@H](C)[NH+]12 |
| InChI | InChI=1S/C18H18N2/c1-13-18(16-11-7-4-8-12-16)17(19-14(2)20(13)18)15-9-5-3-6-10-15/h3-14H,1-2H3/p+1/t13-,14-,18-,20?/m1/s1 |
| InChIKey | XZLNFPPKSCCWQA-UHGIDHBFSA-O |
| XLogP | 2.02 |
| TPSA | 16.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|