C15H25N6O3+ — CID 7000249
1,3,7-trimethyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione (PubChem CID 7000249) has the molecular formula C15H25N6O3+ and a molecular weight of 337.40 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 7000249 |
| Molecular Formula | C15H25N6O3+ |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1,3,7-trimethyl-8-(3-morpholin-4-ium-4-ylpropylamino)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NCCC[NH+]3CCOCC3)n2C)n(C)c1=O |
| InChI | InChI=1S/C15H24N6O3/c1-18-11-12(19(2)15(23)20(3)13(11)22)17-14(18)16-5-4-6-21-7-9-24-10-8-21/h4-10H2,1-3H3,(H,16,17)/p+1 |
| InChIKey | GXUIFHCQIDTXRM-UHFFFAOYSA-O |
| XLogP | -2.31 |
| TPSA | 87.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|