C11H8F3NO4 — CID 70004004
[6-amino-2-(trifluoromethyl)-2H-chromen-3-yl] hydrogen carbonate (PubChem CID 70004004) has the molecular formula C11H8F3NO4 and a molecular weight of 275.18 g/mol. Its IUPAC name is [6-amino-2-(trifluoromethyl)-2H-chromen-3-yl] hydrogen carbonate.
| Compound Name | [6-amino-2-(trifluoromethyl)-2H-chromen-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70004004 |
| Molecular Formula | C11H8F3NO4 |
| Molecular Weight | 275.18 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | [6-amino-2-(trifluoromethyl)-2H-chromen-3-yl] hydrogen carbonate |
| SMILES | Nc1ccc2c(c1)C=C(OC(=O)O)C(C(F)(F)F)O2 |
| InChI | InChI=1S/C11H8F3NO4/c12-11(13,14)9-8(19-10(16)17)4-5-3-6(15)1-2-7(5)18-9/h1-4,9H,15H2,(H,16,17) |
| InChIKey | MDZNNRDKTVYUTG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.18 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|