C29H56N6O3 — CID 70018577
3,3,5,5-tetramethyl-1-propan-2-ylpiperazin-2-one;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one (PubChem CID 70018577) has the molecular formula C29H56N6O3 and a molecular weight of 536.81 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-propan-2-ylpiperazin-2-one;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one.
| Compound Name | 3,3,5,5-tetramethyl-1-propan-2-ylpiperazin-2-one;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
|---|---|
| PubChem CID | 70018577 |
| Molecular Formula | C29H56N6O3 |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.44 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-propan-2-ylpiperazin-2-one;3,3,5,5-tetramethyl-1-[2-(3,3,5,5-tetramethyl-2-oxopiperazin-1-yl)ethyl]piperazin-2-one |
| SMILES | CC(C)N1CC(C)(C)NC(C)(C)C1=O.CC1(C)CN(CCN2CC(C)(C)NC(C)(C)C2=O)C(=O)C(C)(C)N1 |
| InChI | InChI=1S/C18H34N4O2.C11H22N2O/c1-15(2)11-21(13(23)17(5,6)19-15)9-10-22-12-16(3,4)20-18(7,8)14(22)24;1-8(2)13-7-10(3,4)12-11(5,6)9(13)14/h19-20H,9-12H2,1-8H3;8,12H,7H2,1-6H3 |
| InChIKey | IEUNSDAKTGEVSQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |