C32H42FN3O8S — CID 70027180
(E)-but-2-enedioic acid;N-[1-[3-[2-(4-fluorophenyl)ethoxy]propyl]piperidin-4-yl]-6,7,8-trimethoxy-N-methyl-4H-3,1-benzothiazin-2-amine (PubChem CID 70027180) has the molecular formula C32H42FN3O8S and a molecular weight of 647.77 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[1-[3-[2-(4-fluorophenyl)ethoxy]propyl]piperidin-4-yl]-6,7,8-trimethoxy-N-methyl-4H-3,1-benzothiazin-2-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[1-[3-[2-(4-fluorophenyl)ethoxy]propyl]piperidin-4-yl]-6,7,8-trimethoxy-N-methyl-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 70027180 |
| Molecular Formula | C32H42FN3O8S |
| Molecular Weight | 647.77 g/mol |
| Exact Mass | 647.27 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[1-[3-[2-(4-fluorophenyl)ethoxy]propyl]piperidin-4-yl]-6,7,8-trimethoxy-N-methyl-4H-3,1-benzothiazin-2-amine |
| SMILES | COc1cc2c(c(OC)c1OC)N=C(N(C)C1CCN(CCCOCCc3ccc(F)cc3)CC1)SC2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C28H38FN3O4S.C4H4O4/c1-31(28-30-25-21(19-37-28)18-24(33-2)26(34-3)27(25)35-4)23-10-14-32(15-11-23)13-5-16-36-17-12-20-6-8-22(29)9-7-20;5-3(6)1-2-4(7)8/h6-9,18,23H,5,10-17,19H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | MJWGBYUSHBOKPT-WLHGVMLRSA-N |
| XLogP | 4.84 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.77 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|