C29H35F2N3O5S — CID 70027544
(Z)-but-2-enedioic acid;N-[1-[3-[2-(3,4-difluorophenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine (PubChem CID 70027544) has the molecular formula C29H35F2N3O5S and a molecular weight of 575.68 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[1-[3-[2-(3,4-difluorophenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;N-[1-[3-[2-(3,4-difluorophenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 70027544 |
| Molecular Formula | C29H35F2N3O5S |
| Molecular Weight | 575.68 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[1-[3-[2-(3,4-difluorophenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
| SMILES | CN(C1=Nc2ccccc2CS1)C1CCN(CCCOCCc2ccc(F)c(F)c2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H31F2N3OS.C4H4O4/c1-29(25-28-24-6-3-2-5-20(24)18-32-25)21-9-13-30(14-10-21)12-4-15-31-16-11-19-7-8-22(26)23(27)17-19;5-3(6)1-2-4(7)8/h2-3,5-8,17,21H,4,9-16,18H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | PVNGVKIOVUQDBK-BTJKTKAUSA-N |
| XLogP | 4.96 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|