C29H33F2N3O5S — CID 70197273
(Z)-2-[3-[[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-methylamino]-1,5-dihydro-2,4-benzothiazepin-1-yl]but-2-enedioic acid (PubChem CID 70197273) has the molecular formula C29H33F2N3O5S and a molecular weight of 573.66 g/mol. Its IUPAC name is (Z)-2-[3-[[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-methylamino]-1,5-dihydro-2,4-benzothiazepin-1-yl]but-2-enedioic acid.
| Compound Name | (Z)-2-[3-[[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-methylamino]-1,5-dihydro-2,4-benzothiazepin-1-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 70197273 |
| Molecular Formula | C29H33F2N3O5S |
| Molecular Weight | 573.66 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (Z)-2-[3-[[1-[4-(3,4-difluorophenoxy)butyl]piperidin-4-yl]-methylamino]-1,5-dihydro-2,4-benzothiazepin-1-yl]but-2-enedioic acid |
| SMILES | CN(C1=NCc2ccccc2C(/C(=C\C(=O)O)C(=O)O)S1)C1CCN(CCCCOc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C29H33F2N3O5S/c1-33(20-10-13-34(14-11-20)12-4-5-15-39-21-8-9-24(30)25(31)16-21)29-32-18-19-6-2-3-7-22(19)27(40-29)23(28(37)38)17-26(35)36/h2-3,6-9,16-17,20,27H,4-5,10-15,18H2,1H3,(H,35,36)(H,37,38)/b23-17+ |
| InChIKey | FQEKTHKTCAJARY-HAVVHWLPSA-N |
| XLogP | 4.96 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|