C29H37N3O6S — CID 70197408
(Z)-but-2-enedioic acid;N-[1-[4-(4-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine (PubChem CID 70197408) has the molecular formula C29H37N3O6S and a molecular weight of 555.70 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-[1-[4-(4-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine.
| Compound Name | (Z)-but-2-enedioic acid;N-[1-[4-(4-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 70197408 |
| Molecular Formula | C29H37N3O6S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-[1-[4-(4-methoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
| SMILES | COc1ccc(OCCCCN2CCC(N(C)C3=Nc4ccccc4CS3)CC2)cc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H33N3O2S.C4H4O4/c1-27(25-26-24-8-4-3-7-20(24)19-31-25)21-13-16-28(17-14-21)15-5-6-18-30-23-11-9-22(29-2)10-12-23;5-3(6)1-2-4(7)8/h3-4,7-12,21H,5-6,13-19H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | PSAGFRFHIXWDIV-BTJKTKAUSA-N |
| XLogP | 4.90 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|