C30H42N3O6S+ — CID 70027948
(E)-but-2-enedioic acid;1-[1-[4-[(4-methoxyphenyl)methoxy]butyl]piperidin-4-yl]-1-methyl-2,4-dihydro-3,1-benzothiazin-1-ium-2-amine (PubChem CID 70027948) has the molecular formula C30H42N3O6S+ and a molecular weight of 572.75 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[1-[4-[(4-methoxyphenyl)methoxy]butyl]piperidin-4-yl]-1-methyl-2,4-dihydro-3,1-benzothiazin-1-ium-2-amine.
| Compound Name | (E)-but-2-enedioic acid;1-[1-[4-[(4-methoxyphenyl)methoxy]butyl]piperidin-4-yl]-1-methyl-2,4-dihydro-3,1-benzothiazin-1-ium-2-amine |
|---|---|
| PubChem CID | 70027948 |
| Molecular Formula | C30H42N3O6S+ |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[1-[4-[(4-methoxyphenyl)methoxy]butyl]piperidin-4-yl]-1-methyl-2,4-dihydro-3,1-benzothiazin-1-ium-2-amine |
| SMILES | COc1ccc(COCCCCN2CCC([N+]3(C)c4ccccc4CSC3N)CC2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H38N3O2S.C4H4O4/c1-29(25-8-4-3-7-22(25)20-32-26(29)27)23-13-16-28(17-14-23)15-5-6-18-31-19-21-9-11-24(30-2)12-10-21;5-3(6)1-2-4(7)8/h3-4,7-12,23,26H,5-6,13-20,27H2,1-2H3;1-2H,(H,5,6)(H,7,8)/q+1;/b;2-1+ |
| InChIKey | UGSBVAHSQAUIGM-WLHGVMLRSA-N |
| XLogP | 4.29 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|