C30H39N3O6S — CID 70027023
but-2-enedioic acid;N-[1-[3-[2-(4-methoxyphenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine (PubChem CID 70027023) has the molecular formula C30H39N3O6S and a molecular weight of 569.72 g/mol. Its IUPAC name is but-2-enedioic acid;N-[1-[3-[2-(4-methoxyphenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine.
| Compound Name | but-2-enedioic acid;N-[1-[3-[2-(4-methoxyphenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 70027023 |
| Molecular Formula | C30H39N3O6S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | but-2-enedioic acid;N-[1-[3-[2-(4-methoxyphenyl)ethoxy]propyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
| SMILES | COc1ccc(CCOCCCN2CCC(N(C)C3=Nc4ccccc4CS3)CC2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C26H35N3O2S.C4H4O4/c1-28(26-27-25-7-4-3-6-22(25)20-32-26)23-12-16-29(17-13-23)15-5-18-31-19-14-21-8-10-24(30-2)11-9-21;5-3(6)1-2-4(7)8/h3-4,6-11,23H,5,12-20H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | HFSXYUCIVVJBLR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|