C30H39N3O7S — CID 70197473
(E)-but-2-enedioic acid;N-[1-[4-(3,5-dimethoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine (PubChem CID 70197473) has the molecular formula C30H39N3O7S and a molecular weight of 585.72 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[1-[4-(3,5-dimethoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[1-[4-(3,5-dimethoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
|---|---|
| PubChem CID | 70197473 |
| Molecular Formula | C30H39N3O7S |
| Molecular Weight | 585.72 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[1-[4-(3,5-dimethoxyphenoxy)butyl]piperidin-4-yl]-N-methyl-4H-3,1-benzothiazin-2-amine |
| SMILES | COc1cc(OC)cc(OCCCCN2CCC(N(C)C3=Nc4ccccc4CS3)CC2)c1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C26H35N3O3S.C4H4O4/c1-28(26-27-25-9-5-4-8-20(25)19-33-26)21-10-13-29(14-11-21)12-6-7-15-32-24-17-22(30-2)16-23(18-24)31-3;5-3(6)1-2-4(7)8/h4-5,8-9,16-18,21H,6-7,10-15,19H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | RKLIYCRONOQKKL-WLHGVMLRSA-N |
| XLogP | 4.91 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.72 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|