C14H13N5O2 — CID 70045168
(4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea (PubChem CID 70045168) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea.
| Compound Name | (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 70045168 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea |
| SMILES | COc1cc(NC(N)=O)ccc1-c1cn2cccnc2n1 |
| InChI | InChI=1S/C14H13N5O2/c1-21-12-7-9(17-13(15)20)3-4-10(12)11-8-19-6-2-5-16-14(19)18-11/h2-8H,1H3,(H3,15,17,20) |
| InChIKey | XVJNGUGEEYAUSZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |