About (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea
(4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea (PubChem CID 70045168) has the molecular formula C14H13N5O2
and a molecular weight of 283.29 g/mol. Its IUPAC name is (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea.
Molecular Properties
| Compound Name | (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea |
| PubChem CID | 70045168 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea |
| SMILES | COc1cc(NC(N)=O)ccc1-c1cn2cccnc2n1 |
| InChI | InChI=1S/C14H13N5O2/c1-21-12-7-9(17-13(15)20)3-4-10(12)11-8-19-6-2-5-16-14(19)18-11/h2-8H,1H3,(H3,15,17,20) |
| InChIKey | XVJNGUGEEYAUSZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea?
The IUPAC name of (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea (CID 70045168) is (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea.
What is the SMILES notation for (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea?
The canonical SMILES for (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea is COc1cc(NC(N)=O)ccc1-c1cn2cccnc2n1.
What is the InChIKey of (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea?
The InChIKey is XVJNGUGEEYAUSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N5O2/c1-21-12-7-9(17-13(15)20)3-4-10(12)11-8-19-6-2-5-16-14(19)18-11/h2-8H,1H3,(H3,15,17,20).
What are the key properties of (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea?
(4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea has a molecular weight of 283.29 g/mol, XLogP of 1.90, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-imidazo[1,2-a]pyrimidin-2-yl-3-methoxyphenyl)urea is sourced from PubChem (CID 70045168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).