C32H38N4O6 — CID 70069259
2-[2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl(pyridin-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid (PubChem CID 70069259) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is 2-[2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl(pyridin-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid.
| Compound Name | 2-[2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl(pyridin-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
|---|---|
| PubChem CID | 70069259 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | 2-[2-[(4-aminophenyl)methyl]-8-[3-[butoxycarbonyl(pyridin-2-yl)amino]propoxy]-3-oxo-4,5-dihydro-1H-2-benzazepin-4-yl]acetic acid |
| SMILES | CCCCOC(=O)N(CCCOc1ccc2c(c1)CN(Cc1ccc(N)cc1)C(=O)C(CC(=O)O)C2)c1ccccn1 |
| InChI | InChI=1S/C32H38N4O6/c1-2-3-16-42-32(40)36(29-7-4-5-14-34-29)15-6-17-41-28-13-10-24-18-25(20-30(37)38)31(39)35(22-26(24)19-28)21-23-8-11-27(33)12-9-23/h4-5,7-14,19,25H,2-3,6,15-18,20-22,33H2,1H3,(H,37,38) |
| InChIKey | ZDRLBODALGNFLW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|