C10H19NO4PS+ — CID 70131144
butane;[ethoxy(1,3-thiazol-2-yl)methoxy]-hydroxy-oxophosphanium (PubChem CID 70131144) has the molecular formula C10H19NO4PS+ and a molecular weight of 280.31 g/mol. Its IUPAC name is butane;[ethoxy(1,3-thiazol-2-yl)methoxy]-hydroxy-oxophosphanium.
| Compound Name | butane;[ethoxy(1,3-thiazol-2-yl)methoxy]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 70131144 |
| Molecular Formula | C10H19NO4PS+ |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | butane;[ethoxy(1,3-thiazol-2-yl)methoxy]-hydroxy-oxophosphanium |
| SMILES | CCCC.CCOC(O[P+](=O)O)c1nccs1 |
| InChI | InChI=1S/C6H8NO4PS.C4H10/c1-2-10-6(11-12(8)9)5-7-3-4-13-5;1-3-4-2/h3-4,6H,2H2,1H3;3-4H2,1-2H3/p+1 |
| InChIKey | MJKZLEWCBUIKPC-UHFFFAOYSA-O |
| XLogP | 3.65 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|