C31H35ClN2O3 — CID 70132830
6-[4-[(5-chloro-2-phenylbenzoyl)amino]piperidin-1-yl]-3-methyl-3-phenylhexanoic acid (PubChem CID 70132830) has the molecular formula C31H35ClN2O3 and a molecular weight of 519.09 g/mol. Its IUPAC name is 6-[4-[(5-chloro-2-phenylbenzoyl)amino]piperidin-1-yl]-3-methyl-3-phenylhexanoic acid.
| Compound Name | 6-[4-[(5-chloro-2-phenylbenzoyl)amino]piperidin-1-yl]-3-methyl-3-phenylhexanoic acid |
|---|---|
| PubChem CID | 70132830 |
| Molecular Formula | C31H35ClN2O3 |
| Molecular Weight | 519.09 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 6-[4-[(5-chloro-2-phenylbenzoyl)amino]piperidin-1-yl]-3-methyl-3-phenylhexanoic acid |
| SMILES | CC(CCCN1CCC(NC(=O)c2cc(Cl)ccc2-c2ccccc2)CC1)(CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C31H35ClN2O3/c1-31(22-29(35)36,24-11-6-3-7-12-24)17-8-18-34-19-15-26(16-20-34)33-30(37)28-21-25(32)13-14-27(28)23-9-4-2-5-10-23/h2-7,9-14,21,26H,8,15-20,22H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | YGOCNECMJBANHK-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.09 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |