C20H22N4O5S2 — CID 70135394
N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide;(E)-but-2-enedioic acid (PubChem CID 70135394) has the molecular formula C20H22N4O5S2 and a molecular weight of 462.55 g/mol. Its IUPAC name is N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide;(E)-but-2-enedioic acid.
| Compound Name | N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 70135394 |
| Molecular Formula | C20H22N4O5S2 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide;(E)-but-2-enedioic acid |
| SMILES | N/C(=N\c1ccc(C(N)C(=O)C2NCCS2)cc1)c1cccs1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H18N4OS2.C4H4O4/c17-13(14(21)16-19-7-9-23-16)10-3-5-11(6-4-10)20-15(18)12-2-1-8-22-12;5-3(6)1-2-4(7)8/h1-6,8,13,16,19H,7,9,17H2,(H2,18,20);1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IJMCNSZFFHNHKG-WLHGVMLRSA-N |
| XLogP | 1.73 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|