C16H18N4OS2 — CID 70135395
N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide (PubChem CID 70135395) has the molecular formula C16H18N4OS2 and a molecular weight of 346.48 g/mol. Its IUPAC name is N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide.
| Compound Name | N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 70135395 |
| Molecular Formula | C16H18N4OS2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N'-[4-[1-amino-2-oxo-2-(1,3-thiazolidin-2-yl)ethyl]phenyl]thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc(C(N)C(=O)C2NCCS2)cc1)c1cccs1 |
| InChI | InChI=1S/C16H18N4OS2/c17-13(14(21)16-19-7-9-23-16)10-3-5-11(6-4-10)20-15(18)12-2-1-8-22-12/h1-6,8,13,16,19H,7,9,17H2,(H2,18,20) |
| InChIKey | UJTWXQABAAJEGA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|