C16H10Cl2O4 — CID 70138199
(2R)-2-[4-(2,4-dichlorophenyl)phenyl]-3,4-dihydroxy-2H-furan-5-one (PubChem CID 70138199) has the molecular formula C16H10Cl2O4 and a molecular weight of 337.16 g/mol. Its IUPAC name is (2R)-2-[4-(2,4-dichlorophenyl)phenyl]-3,4-dihydroxy-2H-furan-5-one.
| Compound Name | (2R)-2-[4-(2,4-dichlorophenyl)phenyl]-3,4-dihydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 70138199 |
| Molecular Formula | C16H10Cl2O4 |
| Molecular Weight | 337.16 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | (2R)-2-[4-(2,4-dichlorophenyl)phenyl]-3,4-dihydroxy-2H-furan-5-one |
| SMILES | O=C1O[C@H](c2ccc(-c3ccc(Cl)cc3Cl)cc2)C(O)=C1O |
| InChI | InChI=1S/C16H10Cl2O4/c17-10-5-6-11(12(18)7-10)8-1-3-9(4-2-8)15-13(19)14(20)16(21)22-15/h1-7,15,19-20H/t15-/m1/s1 |
| InChIKey | UUUSYVZFZZKQRG-OAHLLOKOSA-N |
| XLogP | 4.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.16 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |