C24H29N3O6S — CID 70145232
4-[(1R)-2-[2,2-bis(4-hydroxyphenyl)ethylamino]-1-hydroxyethyl]-2-(dimethylsulfamoylamino)-1-hydroxybenzene (PubChem CID 70145232) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-[(1R)-2-[2,2-bis(4-hydroxyphenyl)ethylamino]-1-hydroxyethyl]-2-(dimethylsulfamoylamino)-1-hydroxybenzene.
| Compound Name | 4-[(1R)-2-[2,2-bis(4-hydroxyphenyl)ethylamino]-1-hydroxyethyl]-2-(dimethylsulfamoylamino)-1-hydroxybenzene |
|---|---|
| PubChem CID | 70145232 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 4-[(1R)-2-[2,2-bis(4-hydroxyphenyl)ethylamino]-1-hydroxyethyl]-2-(dimethylsulfamoylamino)-1-hydroxybenzene |
| SMILES | CN(C)S(=O)(=O)Nc1cc([C@@H](O)CNCC(c2ccc(O)cc2)c2ccc(O)cc2)ccc1O |
| InChI | InChI=1S/C24H29N3O6S/c1-27(2)34(32,33)26-22-13-18(7-12-23(22)30)24(31)15-25-14-21(16-3-8-19(28)9-4-16)17-5-10-20(29)11-6-17/h3-13,21,24-26,28-31H,14-15H2,1-2H3/t24-/m0/s1 |
| InChIKey | SXQGHXAYQQQFEV-DEOSSOPVSA-N |
| XLogP | 2.48 |
| TPSA | 142.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|