C15H17N3O4 — CID 70155062
5-methoxy-3-[3-methyl-4-[[(Z)-4-oxopent-2-en-2-yl]amino]phenyl]-1,3,4-oxadiazol-2-one (PubChem CID 70155062) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is 5-methoxy-3-[3-methyl-4-[[(Z)-4-oxopent-2-en-2-yl]amino]phenyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 5-methoxy-3-[3-methyl-4-[[(Z)-4-oxopent-2-en-2-yl]amino]phenyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 70155062 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 5-methoxy-3-[3-methyl-4-[[(Z)-4-oxopent-2-en-2-yl]amino]phenyl]-1,3,4-oxadiazol-2-one |
| SMILES | COc1nn(-c2ccc(N/C(C)=C\C(C)=O)c(C)c2)c(=O)o1 |
| InChI | InChI=1S/C15H17N3O4/c1-9-7-12(18-15(20)22-14(17-18)21-4)5-6-13(9)16-10(2)8-11(3)19/h5-8,16H,1-4H3/b10-8- |
| InChIKey | CFTRDLYCSWTIAM-NTMALXAHSA-N |
| XLogP | 2.05 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|