C31H38O2 — CID 70182258
ethyl 4-[[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hex-2-enyl]methyl]benzoate (PubChem CID 70182258) has the molecular formula C31H38O2 and a molecular weight of 442.64 g/mol. Its IUPAC name is ethyl 4-[[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hex-2-enyl]methyl]benzoate.
| Compound Name | ethyl 4-[[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hex-2-enyl]methyl]benzoate |
|---|---|
| PubChem CID | 70182258 |
| Molecular Formula | C31H38O2 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | ethyl 4-[[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)-2-bicyclo[3.1.0]hex-2-enyl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CC2=CCC3CC23c2cc3c(cc2C)C(C)(C)CCC3(C)C)cc1 |
| InChI | InChI=1S/C31H38O2/c1-7-33-28(32)22-10-8-21(9-11-22)17-23-12-13-24-19-31(23,24)25-18-27-26(16-20(25)2)29(3,4)14-15-30(27,5)6/h8-12,16,18,24H,7,13-15,17,19H2,1-6H3 |
| InChIKey | TVXPSQLNGXLXGU-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|