C31H43NO3 — CID 70186940
3-[4-[(4-decoxyphenyl)methylideneamino]-2-(2-methylbutyl)phenyl]prop-2-enoic acid (PubChem CID 70186940) has the molecular formula C31H43NO3 and a molecular weight of 477.69 g/mol. Its IUPAC name is 3-[4-[(4-decoxyphenyl)methylideneamino]-2-(2-methylbutyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[(4-decoxyphenyl)methylideneamino]-2-(2-methylbutyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70186940 |
| Molecular Formula | C31H43NO3 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | 3-[4-[(4-decoxyphenyl)methylideneamino]-2-(2-methylbutyl)phenyl]prop-2-enoic acid |
| SMILES | CCCCCCCCCCOc1ccc(/C=N/c2ccc(C=CC(=O)O)c(CC(C)CC)c2)cc1 |
| InChI | InChI=1S/C31H43NO3/c1-4-6-7-8-9-10-11-12-21-35-30-18-13-26(14-19-30)24-32-29-17-15-27(16-20-31(33)34)28(23-29)22-25(3)5-2/h13-20,23-25H,4-12,21-22H2,1-3H3,(H,33,34)/b20-16?,32-24+ |
| InChIKey | RZHUZNNRIZKPOG-NWZJBASHSA-N |
| XLogP | 8.64 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|