C42H43NO4 — CID 70187066
2-methoxy-3-[4-[2-[methyl-[6-phenyl-14-(2-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,11,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 70187066) has the molecular formula C42H43NO4 and a molecular weight of 625.81 g/mol. Its IUPAC name is 2-methoxy-3-[4-[2-[methyl-[6-phenyl-14-(2-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,11,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-methoxy-3-[4-[2-[methyl-[6-phenyl-14-(2-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,11,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 70187066 |
| Molecular Formula | C42H43NO4 |
| Molecular Weight | 625.81 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | 2-methoxy-3-[4-[2-[methyl-[6-phenyl-14-(2-phenylethyl)-2-tricyclo[9.4.0.03,8]pentadeca-1,3(8),4,6,11,14-hexaenyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | COC(Cc1ccc(OCCN(C)C2=C3C=C(CCc4ccccc4)CC=C3CCc3cc(-c4ccccc4)ccc32)cc1)C(=O)O |
| InChI | InChI=1S/C42H43NO4/c1-43(25-26-47-37-22-16-32(17-23-37)28-40(46-2)42(44)45)41-38-24-21-35(33-11-7-4-8-12-33)29-36(38)20-19-34-18-15-31(27-39(34)41)14-13-30-9-5-3-6-10-30/h3-12,16-18,21-24,27,29,40H,13-15,19-20,25-26,28H2,1-2H3,(H,44,45) |
| InChIKey | NOCZBVHNHIHHAY-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.81 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |