C28H42ClNO2 — CID 70192115
(6E,10E)-N-(1,3-benzodioxol-5-ylmethyl)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine;hydrochloride (PubChem CID 70192115) has the molecular formula C28H42ClNO2 and a molecular weight of 460.10 g/mol. Its IUPAC name is (6E,10E)-N-(1,3-benzodioxol-5-ylmethyl)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine;hydrochloride.
| Compound Name | (6E,10E)-N-(1,3-benzodioxol-5-ylmethyl)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine;hydrochloride |
|---|---|
| PubChem CID | 70192115 |
| Molecular Formula | C28H42ClNO2 |
| Molecular Weight | 460.10 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | (6E,10E)-N-(1,3-benzodioxol-5-ylmethyl)-2,6,11,15-tetramethylhexadeca-2,6,10,14-tetraen-8-amine;hydrochloride |
| SMILES | CC(C)=CCC/C(C)=C/CC(/C=C(\C)CCC=C(C)C)NCc1ccc2c(c1)OCO2.Cl |
| InChI | InChI=1S/C28H41NO2.ClH/c1-21(2)9-7-11-23(5)13-15-26(17-24(6)12-8-10-22(3)4)29-19-25-14-16-27-28(18-25)31-20-30-27;/h9-10,13-14,16-18,26,29H,7-8,11-12,15,19-20H2,1-6H3;1H/b23-13+,24-17+; |
| InChIKey | BBIFEXFYQUFEGD-UYWFYPLTSA-N |
| XLogP | 8.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.10 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|