C23H29FN4O6 — CID 70198252
[2-[(7aS)-6-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl] acetate (PubChem CID 70198252) has the molecular formula C23H29FN4O6 and a molecular weight of 476.51 g/mol. Its IUPAC name is [2-[(7aS)-6-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(7aS)-6-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 70198252 |
| Molecular Formula | C23H29FN4O6 |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [2-[(7aS)-6-[4-[5-(acetamidomethyl)-2-oxo-1,3-oxazolidin-3-yl]-2-fluorophenyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CC4CCCN(C(=O)COC(C)=O)[C@@H]4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C23H29FN4O6/c1-14(29)25-9-18-11-28(23(32)34-18)17-5-6-20(19(24)8-17)26-10-16-4-3-7-27(21(16)12-26)22(31)13-33-15(2)30/h5-6,8,16,18,21H,3-4,7,9-13H2,1-2H3,(H,25,29)/t16?,18?,21-/m1/s1 |
| InChIKey | FPRGFKZYMBMYFG-QYGXFBIXSA-N |
| XLogP | 1.28 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|