C22H29FN4O5 — CID 70202340
N-[[3-[4-[(7aS)-1-(2-methoxyacetyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 70202340) has the molecular formula C22H29FN4O5 and a molecular weight of 448.50 g/mol. Its IUPAC name is N-[[3-[4-[(7aS)-1-(2-methoxyacetyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(7aS)-1-(2-methoxyacetyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 70202340 |
| Molecular Formula | C22H29FN4O5 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | N-[[3-[4-[(7aS)-1-(2-methoxyacetyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | COCC(=O)N1CCCC2CN(c3ccc(N4CC(CNC(C)=O)OC4=O)cc3F)C[C@H]21 |
| InChI | InChI=1S/C22H29FN4O5/c1-14(28)24-9-17-11-27(22(30)32-17)16-5-6-19(18(23)8-16)25-10-15-4-3-7-26(20(15)12-25)21(29)13-31-2/h5-6,8,15,17,20H,3-4,7,9-13H2,1-2H3,(H,24,28)/t15?,17?,20-/m1/s1 |
| InChIKey | ZGXOPSSKXZYHKC-MKJPBZQASA-N |
| XLogP | 1.36 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|