C25H36FN5O6S — CID 70202498
N-[[3-[4-[(7aS)-1-(2-morpholin-4-ylsulfonylethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide (PubChem CID 70202498) has the molecular formula C25H36FN5O6S and a molecular weight of 553.66 g/mol. Its IUPAC name is N-[[3-[4-[(7aS)-1-(2-morpholin-4-ylsulfonylethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(7aS)-1-(2-morpholin-4-ylsulfonylethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
|---|---|
| PubChem CID | 70202498 |
| Molecular Formula | C25H36FN5O6S |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | N-[[3-[4-[(7aS)-1-(2-morpholin-4-ylsulfonylethyl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-6-yl]-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]acetamide |
| SMILES | CC(=O)NCC1CN(c2ccc(N3CC4CCCN(CCS(=O)(=O)N5CCOCC5)[C@@H]4C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C25H36FN5O6S/c1-18(32)27-14-21-16-31(25(33)37-21)20-4-5-23(22(26)13-20)29-15-19-3-2-6-28(24(19)17-29)9-12-38(34,35)30-7-10-36-11-8-30/h4-5,13,19,21,24H,2-3,6-12,14-17H2,1H3,(H,27,32)/t19?,21?,24-/m1/s1 |
| InChIKey | IPACAODMXUCJCG-NFDBJIOVSA-N |
| XLogP | 0.85 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|