C36H35N3O6 — CID 70202698
(1R)-2-[[(2S)-1-hydroxy-3-(4-pyridin-2-yloxyphenyl)propan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)-3-phenylpropan-1-ol (PubChem CID 70202698) has the molecular formula C36H35N3O6 and a molecular weight of 605.69 g/mol. Its IUPAC name is (1R)-2-[[(2S)-1-hydroxy-3-(4-pyridin-2-yloxyphenyl)propan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)-3-phenylpropan-1-ol.
| Compound Name | (1R)-2-[[(2S)-1-hydroxy-3-(4-pyridin-2-yloxyphenyl)propan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 70202698 |
| Molecular Formula | C36H35N3O6 |
| Molecular Weight | 605.69 g/mol |
| Exact Mass | 605.25 |
| IUPAC Name | (1R)-2-[[(2S)-1-hydroxy-3-(4-pyridin-2-yloxyphenyl)propan-2-yl]amino]-1-(3-nitro-4-phenylmethoxyphenyl)-3-phenylpropan-1-ol |
| SMILES | O=[N+]([O-])c1cc([C@@H](O)C(Cc2ccccc2)N[C@H](CO)Cc2ccc(Oc3ccccn3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C36H35N3O6/c40-24-30(21-27-14-17-31(18-15-27)45-35-13-7-8-20-37-35)38-32(22-26-9-3-1-4-10-26)36(41)29-16-19-34(33(23-29)39(42)43)44-25-28-11-5-2-6-12-28/h1-20,23,30,32,36,38,40-41H,21-22,24-25H2/t30-,32?,36+/m0/s1 |
| InChIKey | MMVMEDJYQPZHKW-SGYAWBACSA-N |
| XLogP | 6.20 |
| TPSA | 126.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.69 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|