C24H30N4O2 — CID 70210401
(2R)-2,5-diamino-N-[(1R)-1-(4-benzyl-1,3-oxazol-2-yl)-3-phenylpropyl]pentanamide (PubChem CID 70210401) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is (2R)-2,5-diamino-N-[(1R)-1-(4-benzyl-1,3-oxazol-2-yl)-3-phenylpropyl]pentanamide.
| Compound Name | (2R)-2,5-diamino-N-[(1R)-1-(4-benzyl-1,3-oxazol-2-yl)-3-phenylpropyl]pentanamide |
|---|---|
| PubChem CID | 70210401 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | (2R)-2,5-diamino-N-[(1R)-1-(4-benzyl-1,3-oxazol-2-yl)-3-phenylpropyl]pentanamide |
| SMILES | NCCC[C@@H](N)C(=O)N[C@H](CCc1ccccc1)c1nc(Cc2ccccc2)co1 |
| InChI | InChI=1S/C24H30N4O2/c25-15-7-12-21(26)23(29)28-22(14-13-18-8-3-1-4-9-18)24-27-20(17-30-24)16-19-10-5-2-6-11-19/h1-6,8-11,17,21-22H,7,12-16,25-26H2,(H,28,29)/t21-,22-/m1/s1 |
| InChIKey | GXCHDUYXNBZWIR-FGZHOGPDSA-N |
| XLogP | 3.12 |
| TPSA | 107.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |