C24H21N3O2 — CID 70211935
3-[3-[2-[3-(hydrazinylmethylideneamino)phenyl]ethynyl]phenyl]-3-phenylpropanoic acid (PubChem CID 70211935) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-[3-[2-[3-(hydrazinylmethylideneamino)phenyl]ethynyl]phenyl]-3-phenylpropanoic acid.
| Compound Name | 3-[3-[2-[3-(hydrazinylmethylideneamino)phenyl]ethynyl]phenyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70211935 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-[3-[2-[3-(hydrazinylmethylideneamino)phenyl]ethynyl]phenyl]-3-phenylpropanoic acid |
| SMILES | NN/C=N/c1cccc(C#Cc2cccc(C(CC(=O)O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H21N3O2/c25-27-17-26-22-11-5-7-19(15-22)13-12-18-6-4-10-21(14-18)23(16-24(28)29)20-8-2-1-3-9-20/h1-11,14-15,17,23H,16,25H2,(H,26,27)(H,28,29) |
| InChIKey | DXBAILAHYWJOCM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|