C23H24N4O2 — CID 70211930
3-[3-[[3-(hydrazinylmethylideneamino)phenyl]methylamino]phenyl]-3-phenylpropanoic acid (PubChem CID 70211930) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 3-[3-[[3-(hydrazinylmethylideneamino)phenyl]methylamino]phenyl]-3-phenylpropanoic acid.
| Compound Name | 3-[3-[[3-(hydrazinylmethylideneamino)phenyl]methylamino]phenyl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70211930 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-[3-[[3-(hydrazinylmethylideneamino)phenyl]methylamino]phenyl]-3-phenylpropanoic acid |
| SMILES | NN/C=N/c1cccc(CNc2cccc(C(CC(=O)O)c3ccccc3)c2)c1 |
| InChI | InChI=1S/C23H24N4O2/c24-27-16-26-20-10-4-6-17(12-20)15-25-21-11-5-9-19(13-21)22(14-23(28)29)18-7-2-1-3-8-18/h1-13,16,22,25H,14-15,24H2,(H,26,27)(H,28,29) |
| InChIKey | QFUWXMUGHCRHBM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|