C22H25F2NO4 — CID 70235481
tert-butyl N-[(2S)-1-(3,5-difluorophenoxy)-3-oxo-5-phenylpentan-2-yl]carbamate (PubChem CID 70235481) has the molecular formula C22H25F2NO4 and a molecular weight of 405.44 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-(3,5-difluorophenoxy)-3-oxo-5-phenylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-(3,5-difluorophenoxy)-3-oxo-5-phenylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 70235481 |
| Molecular Formula | C22H25F2NO4 |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | tert-butyl N-[(2S)-1-(3,5-difluorophenoxy)-3-oxo-5-phenylpentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](COc1cc(F)cc(F)c1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C22H25F2NO4/c1-22(2,3)29-21(27)25-19(14-28-18-12-16(23)11-17(24)13-18)20(26)10-9-15-7-5-4-6-8-15/h4-8,11-13,19H,9-10,14H2,1-3H3,(H,25,27)/t19-/m0/s1 |
| InChIKey | NVUYZSZKYAGADC-IBGZPJMESA-N |
| XLogP | 4.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |