C22H27F2NO4 — CID 143972967
tert-butyl N-[(2S,6Z)-1-(3,5-difluorophenoxy)-6-ethenyl-3-oxonona-6,8-dien-2-yl]carbamate (PubChem CID 143972967) has the molecular formula C22H27F2NO4 and a molecular weight of 407.46 g/mol. Its IUPAC name is tert-butyl N-[(2S,6Z)-1-(3,5-difluorophenoxy)-6-ethenyl-3-oxonona-6,8-dien-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,6Z)-1-(3,5-difluorophenoxy)-6-ethenyl-3-oxonona-6,8-dien-2-yl]carbamate |
|---|---|
| PubChem CID | 143972967 |
| Molecular Formula | C22H27F2NO4 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | tert-butyl N-[(2S,6Z)-1-(3,5-difluorophenoxy)-6-ethenyl-3-oxonona-6,8-dien-2-yl]carbamate |
| SMILES | C=C/C=C(\C=C)CCC(=O)[C@H](COc1cc(F)cc(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27F2NO4/c1-6-8-15(7-2)9-10-20(26)19(25-21(27)29-22(3,4)5)14-28-18-12-16(23)11-17(24)13-18/h6-8,11-13,19H,1-2,9-10,14H2,3-5H3,(H,25,27)/b15-8+/t19-/m0/s1 |
| InChIKey | RBLOZGOTEJKDAD-UCSSQIFYSA-N |
| XLogP | 4.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|