C22H32Cl2N10 — CID 70235826
1-[N'-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]carbamimidoyl]-2-(4-chlorocyclohexa-2,4-dien-1-yl)guanidine (PubChem CID 70235826) has the molecular formula C22H32Cl2N10 and a molecular weight of 507.47 g/mol. Its IUPAC name is 1-[N'-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]carbamimidoyl]-2-(4-chlorocyclohexa-2,4-dien-1-yl)guanidine.
| Compound Name | 1-[N'-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]carbamimidoyl]-2-(4-chlorocyclohexa-2,4-dien-1-yl)guanidine |
|---|---|
| PubChem CID | 70235826 |
| Molecular Formula | C22H32Cl2N10 |
| Molecular Weight | 507.47 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 1-[N'-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]carbamimidoyl]-2-(4-chlorocyclohexa-2,4-dien-1-yl)guanidine |
| SMILES | NC(=N/C(N)=N/CCCCCC/N=C(\N)N/C(N)=N/C1C=CC(Cl)=CC1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H32Cl2N10/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18/h5-11,18H,1-4,12-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34) |
| InChIKey | IQBINACXFVEKBQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 177.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|