C21H25ClN4O2+2 — CID 7024069
(3S)-1-(4-chlorophenyl)-3-[4-(2-pyridin-2-ylethyl)piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione (PubChem CID 7024069) has the molecular formula C21H25ClN4O2+2 and a molecular weight of 400.91 g/mol. Its IUPAC name is (3S)-1-(4-chlorophenyl)-3-[4-(2-pyridin-2-ylethyl)piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(4-chlorophenyl)-3-[4-(2-pyridin-2-ylethyl)piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 7024069 |
| Molecular Formula | C21H25ClN4O2+2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (3S)-1-(4-chlorophenyl)-3-[4-(2-pyridin-2-ylethyl)piperazine-1,4-diium-1-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H]([NH+]2CC[NH+](CCc3ccccn3)CC2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H23ClN4O2/c22-16-4-6-18(7-5-16)26-20(27)15-19(21(26)28)25-13-11-24(12-14-25)10-8-17-3-1-2-9-23-17/h1-7,9,19H,8,10-15H2/p+2/t19-/m0/s1 |
| InChIKey | UXQBNVPQIQWIAU-IBGZPJMESA-P |
| XLogP | -0.61 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|