About 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid
6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid (PubChem CID 70240802) has the molecular formula C22H36O7
and a molecular weight of 412.52 g/mol. Its IUPAC name is 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid.
Molecular Properties
| Compound Name | 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid |
| PubChem CID | 70240802 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid |
| SMILES | CCCCC(=O)C1(CCCC)C=C(O)C(C)C(=O)O1.CCCCC(=O)CC(=O)O |
| InChI | InChI=1S/C15H24O4.C7H12O3/c1-4-6-8-13(17)15(9-7-5-2)10-12(16)11(3)14(18)19-15;1-2-3-4-6(8)5-7(9)10/h10-11,16H,4-9H2,1-3H3;2-5H2,1H3,(H,9,10) |
| InChIKey | AEECTPYQAGUPNY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid?
The IUPAC name of 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid (CID 70240802) is 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid.
What is the SMILES notation for 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid?
The canonical SMILES for 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid is CCCCC(=O)C1(CCCC)C=C(O)C(C)C(=O)O1.CCCCC(=O)CC(=O)O.
What is the InChIKey of 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid?
The InChIKey is AEECTPYQAGUPNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4.C7H12O3/c1-4-6-8-13(17)15(9-7-5-2)10-12(16)11(3)14(18)19-15;1-2-3-4-6(8)5-7(9)10/h10-11,16H,4-9H2,1-3H3;2-5H2,1H3,(H,9,10).
What are the key properties of 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid?
6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid has a molecular weight of 412.52 g/mol, XLogP of 4.53, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-4-hydroxy-3-methyl-6-pentanoyl-3H-pyran-2-one;3-oxoheptanoic acid is sourced from PubChem (CID 70240802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).