C19H16NO5S- — CID 7024536
2-[4-[2-(1,3-benzothiazol-2-yl)acetyl]-2-ethyl-5-hydroxyphenoxy]acetate (PubChem CID 7024536) has the molecular formula C19H16NO5S- and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[4-[2-(1,3-benzothiazol-2-yl)acetyl]-2-ethyl-5-hydroxyphenoxy]acetate.
| Compound Name | 2-[4-[2-(1,3-benzothiazol-2-yl)acetyl]-2-ethyl-5-hydroxyphenoxy]acetate |
|---|---|
| PubChem CID | 7024536 |
| Molecular Formula | C19H16NO5S- |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 2-[4-[2-(1,3-benzothiazol-2-yl)acetyl]-2-ethyl-5-hydroxyphenoxy]acetate |
| SMILES | CCc1cc(C(=O)Cc2nc3ccccc3s2)c(O)cc1OCC(=O)[O-] |
| InChI | InChI=1S/C19H17NO5S/c1-2-11-7-12(14(21)8-16(11)25-10-19(23)24)15(22)9-18-20-13-5-3-4-6-17(13)26-18/h3-8,21H,2,9-10H2,1H3,(H,23,24)/p-1 |
| InChIKey | CQKCFHDCGITRJJ-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 99.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |