C23H40O8 — CID 70267686
[(4R,5R)-5-carboxyoxy-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate (PubChem CID 70267686) has the molecular formula C23H40O8 and a molecular weight of 444.57 g/mol. Its IUPAC name is [(4R,5R)-5-carboxyoxy-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate.
| Compound Name | [(4R,5R)-5-carboxyoxy-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 70267686 |
| Molecular Formula | C23H40O8 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | [(4R,5R)-5-carboxyoxy-2-(6,10,14-trimethylpentadec-1-en-2-yl)-1,3-dioxolan-4-yl] hydrogen carbonate |
| SMILES | C=C(CCCC(C)CCCC(C)CCCC(C)C)C1O[C@H](OC(=O)O)[C@@H](OC(=O)O)O1 |
| InChI | InChI=1S/C23H40O8/c1-15(2)9-6-10-16(3)11-7-12-17(4)13-8-14-18(5)19-28-20(30-22(24)25)21(29-19)31-23(26)27/h15-17,19-21H,5-14H2,1-4H3,(H,24,25)(H,26,27)/t16?,17?,20-,21-/m1/s1 |
| InChIKey | BBSIVXFHNIKNOP-XRUXWCASSA-N |
| XLogP | 6.40 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|