C26H28FN5O3 — CID 70275467
8-amino-7-fluoro-11-(1-hydroxyethenyl)-6-[3-(pyridin-2-ylamino)pyrrolidin-1-yl]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one (PubChem CID 70275467) has the molecular formula C26H28FN5O3 and a molecular weight of 477.54 g/mol. Its IUPAC name is 8-amino-7-fluoro-11-(1-hydroxyethenyl)-6-[3-(pyridin-2-ylamino)pyrrolidin-1-yl]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one.
| Compound Name | 8-amino-7-fluoro-11-(1-hydroxyethenyl)-6-[3-(pyridin-2-ylamino)pyrrolidin-1-yl]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one |
|---|---|
| PubChem CID | 70275467 |
| Molecular Formula | C26H28FN5O3 |
| Molecular Weight | 477.54 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 8-amino-7-fluoro-11-(1-hydroxyethenyl)-6-[3-(pyridin-2-ylamino)pyrrolidin-1-yl]spiro[4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-2,1'-cyclopentane]-10-one |
| SMILES | C=C(O)c1cn2c3c(c(N4CCC(Nc5ccccn5)C4)c(F)c(N)c3c1=O)OCC21CCCC1 |
| InChI | InChI=1S/C26H28FN5O3/c1-15(33)17-13-32-22-19(24(17)34)21(28)20(27)23(25(22)35-14-26(32)8-3-4-9-26)31-11-7-16(12-31)30-18-6-2-5-10-29-18/h2,5-6,10,13,16,33H,1,3-4,7-9,11-12,14,28H2,(H,29,30) |
| InChIKey | JOWWDUHACFFMQP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|