C28H31N7O3 — CID 70280373
5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide (PubChem CID 70280373) has the molecular formula C28H31N7O3 and a molecular weight of 513.60 g/mol. Its IUPAC name is 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide.
| Compound Name | 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide |
|---|---|
| PubChem CID | 70280373 |
| Molecular Formula | C28H31N7O3 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 5-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-[(2,2-diphenylacetyl)amino]-N-[(4-hydroxyphenyl)methyl]pentanamide |
| SMILES | Nc1nc(NCCCC(NC(=O)C(c2ccccc2)c2ccccc2)C(=O)NCc2ccc(O)cc2)n[nH]1 |
| InChI | InChI=1S/C28H31N7O3/c29-27-33-28(35-34-27)30-17-7-12-23(25(37)31-18-19-13-15-22(36)16-14-19)32-26(38)24(20-8-3-1-4-9-20)21-10-5-2-6-11-21/h1-6,8-11,13-16,23-24,36H,7,12,17-18H2,(H,31,37)(H,32,38)(H4,29,30,33,34,35) |
| InChIKey | GRSJXEKPXAEXBK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|