About tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane
tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane (PubChem CID 70284906) has the molecular formula C17H23N3O4Si
and a molecular weight of 361.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane |
| PubChem CID | 70284906 |
| Molecular Formula | C17H23N3O4Si |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cn2c(n1)COc1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C17H23N3O4Si/c1-17(2,3)25(4,5)24-10-12-9-19-14-7-6-13(20(21)22)8-15(14)23-11-16(19)18-12/h6-9H,10-11H2,1-5H3 |
| InChIKey | XJALCEIMLWBXTN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane?
The IUPAC name of tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane (CID 70284906) is tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane.
What is the SMILES notation for tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane?
The canonical SMILES for tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane is CC(C)(C)[Si](C)(C)OCc1cn2c(n1)COc1cc([N+](=O)[O-])ccc1-2.
What is the InChIKey of tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane?
The InChIKey is XJALCEIMLWBXTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23N3O4Si/c1-17(2,3)25(4,5)24-10-12-9-19-14-7-6-13(20(21)22)8-15(14)23-11-16(19)18-12/h6-9H,10-11H2,1-5H3.
What are the key properties of tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane?
tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane has a molecular weight of 361.47 g/mol, XLogP of 4.19, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[(7-nitro-4H-imidazo[2,1-c][1,4]benzoxazin-2-yl)methoxy]silane is sourced from PubChem (CID 70284906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).