C10H8FN3O — CID 89228080
9-fluoro-4H-imidazo[2,1-c][1,4]benzoxazin-7-amine (PubChem CID 89228080) has the molecular formula C10H8FN3O and a molecular weight of 205.19 g/mol. Its IUPAC name is 9-fluoro-4H-imidazo[2,1-c][1,4]benzoxazin-7-amine.
| Compound Name | 9-fluoro-4H-imidazo[2,1-c][1,4]benzoxazin-7-amine |
|---|---|
| PubChem CID | 89228080 |
| Molecular Formula | C10H8FN3O |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 9-fluoro-4H-imidazo[2,1-c][1,4]benzoxazin-7-amine |
| SMILES | Nc1cc(F)c2c(c1)OCc1nccn1-2 |
| InChI | InChI=1S/C10H8FN3O/c11-7-3-6(12)4-8-10(7)14-2-1-13-9(14)5-15-8/h1-4H,5,12H2 |
| InChIKey | MUAUNJLAMREVPA-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|