C15H11N — CID 70288039
11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13,15-heptaene (PubChem CID 70288039) has the molecular formula C15H11N and a molecular weight of 205.26 g/mol. Its IUPAC name is 11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13,15-heptaene.
| Compound Name | 11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13,15-heptaene |
|---|---|
| PubChem CID | 70288039 |
| Molecular Formula | C15H11N |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 11-azatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13,15-heptaene |
| SMILES | C1=Cc2cc3c4ccccc4ccc3n2C1 |
| InChI | InChI=1S/C15H11N/c1-2-6-13-11(4-1)7-8-15-14(13)10-12-5-3-9-16(12)15/h1-8,10H,9H2 |
| InChIKey | KQAVGPQKIQRXJP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |