C32H47N3O4 — CID 70291471
3-(4-decoxy-3,5-dimethoxyphenyl)-N-[4-(2-methylphenyl)piperazin-1-yl]prop-2-enamide (PubChem CID 70291471) has the molecular formula C32H47N3O4 and a molecular weight of 537.75 g/mol. Its IUPAC name is 3-(4-decoxy-3,5-dimethoxyphenyl)-N-[4-(2-methylphenyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | 3-(4-decoxy-3,5-dimethoxyphenyl)-N-[4-(2-methylphenyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 70291471 |
| Molecular Formula | C32H47N3O4 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.36 |
| IUPAC Name | 3-(4-decoxy-3,5-dimethoxyphenyl)-N-[4-(2-methylphenyl)piperazin-1-yl]prop-2-enamide |
| SMILES | CCCCCCCCCCOc1c(OC)cc(C=CC(=O)NN2CCN(c3ccccc3C)CC2)cc1OC |
| InChI | InChI=1S/C32H47N3O4/c1-5-6-7-8-9-10-11-14-23-39-32-29(37-3)24-27(25-30(32)38-4)17-18-31(36)33-35-21-19-34(20-22-35)28-16-13-12-15-26(28)2/h12-13,15-18,24-25H,5-11,14,19-23H2,1-4H3,(H,33,36) |
| InChIKey | PVMBJMVMEWAVIY-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|